C23H23N3O2S — CID 46563897
N-[3-[(2-methyl-4-pyrrolidin-1-ylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 46563897) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[3-[(2-methyl-4-pyrrolidin-1-ylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(2-methyl-4-pyrrolidin-1-ylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46563897 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[3-[(2-methyl-4-pyrrolidin-1-ylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C23H23N3O2S/c1-16-14-19(26-11-2-3-12-26)9-10-20(16)25-22(27)17-6-4-7-18(15-17)24-23(28)21-8-5-13-29-21/h4-10,13-15H,2-3,11-12H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | DJJIBZNOJSAZDK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|