C14H12F4N2O6 — CID 145307735
3-[(2-formamidoacetyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 145307735) has the molecular formula C14H12F4N2O6 and a molecular weight of 380.25 g/mol. Its IUPAC name is 3-[(2-formamidoacetyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 3-[(2-formamidoacetyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 145307735 |
| Molecular Formula | C14H12F4N2O6 |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3-[(2-formamidoacetyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=CNCC(=O)NC(CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H12F4N2O6/c15-6-1-7(16)13(18)14(12(6)17)26-4-9(22)8(2-11(24)25)20-10(23)3-19-5-21/h1,5,8H,2-4H2,(H,19,21)(H,20,23)(H,24,25) |
| InChIKey | TZFKMBYJTBFIRC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|