C25H24F4N2O7 — CID 138480242
(3S)-4-oxo-3-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480242) has the molecular formula C25H24F4N2O7 and a molecular weight of 540.47 g/mol. Its IUPAC name is (3S)-4-oxo-3-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-4-oxo-3-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480242 |
| Molecular Formula | C25H24F4N2O7 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | (3S)-4-oxo-3-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CCN(C(=O)OCc2ccccc2)CC1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C25H24F4N2O7/c26-16-10-17(27)22(29)23(21(16)28)37-13-19(32)18(11-20(33)34)30-24(35)15-6-8-31(9-7-15)25(36)38-12-14-4-2-1-3-5-14/h1-5,10,15,18H,6-9,11-13H2,(H,30,35)(H,33,34)/t18-/m0/s1 |
| InChIKey | ITTCUKONTKXORX-SFHVURJKSA-N |
| XLogP | 3.20 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|