C25H29F4N3O7 — CID 145399512
3-[[1-[2-(cyclopentylmethylamino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 145399512) has the molecular formula C25H29F4N3O7 and a molecular weight of 559.51 g/mol. Its IUPAC name is 3-[[1-[2-(cyclopentylmethylamino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 3-[[1-[2-(cyclopentylmethylamino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 145399512 |
| Molecular Formula | C25H29F4N3O7 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 3-[[1-[2-(cyclopentylmethylamino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1CCN(C(=O)C(=O)NCC2CCCC2)CC1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C25H29F4N3O7/c26-15-9-16(27)21(29)22(20(15)28)39-12-18(33)17(10-19(34)35)31-23(36)14-5-7-32(8-6-14)25(38)24(37)30-11-13-3-1-2-4-13/h9,13-14,17H,1-8,10-12H2,(H,30,37)(H,31,36)(H,34,35) |
| InChIKey | VHJGHGDGZFKVQB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|