C34H40F3N3O7 — CID 145399365
(3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-[2,3,5-trifluoro-6-[(E)-pent-1-enyl]phenoxy]pentanoic acid (PubChem CID 145399365) has the molecular formula C34H40F3N3O7 and a molecular weight of 659.70 g/mol. Its IUPAC name is (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-[2,3,5-trifluoro-6-[(E)-pent-1-enyl]phenoxy]pentanoic acid.
| Compound Name | (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-[2,3,5-trifluoro-6-[(E)-pent-1-enyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 145399365 |
| Molecular Formula | C34H40F3N3O7 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-[2,3,5-trifluoro-6-[(E)-pent-1-enyl]phenoxy]pentanoic acid |
| SMILES | CCC/C=C/c1c(F)cc(F)c(F)c1OCC(=O)[C@H](CC(=O)O)NC(=O)C1CCN(C(=O)C(=O)Nc2ccccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C34H40F3N3O7/c1-5-6-7-10-21-23(35)17-24(36)29(37)30(21)47-19-27(41)26(18-28(42)43)39-31(44)20-13-15-40(16-14-20)33(46)32(45)38-25-12-9-8-11-22(25)34(2,3)4/h7-12,17,20,26H,5-6,13-16,18-19H2,1-4H3,(H,38,45)(H,39,44)(H,42,43)/b10-7+/t26-/m0/s1 |
| InChIKey | MTBLKUXRNFKCQX-ZRFNAWPJSA-N |
| XLogP | 5.00 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|