C33H38F3N3O7 — CID 138480314
prop-2-enyl (3S)-3-[[(3R)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate (PubChem CID 138480314) has the molecular formula C33H38F3N3O7 and a molecular weight of 645.68 g/mol. Its IUPAC name is prop-2-enyl (3S)-3-[[(3R)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate.
| Compound Name | prop-2-enyl (3S)-3-[[(3R)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate |
|---|---|
| PubChem CID | 138480314 |
| Molecular Formula | C33H38F3N3O7 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | prop-2-enyl (3S)-3-[[(3R)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate |
| SMILES | C=CCOC(=O)C[C@H](NC(=O)[C@@H]1CCCN(C(=O)C(=O)Nc2ccccc2C(C)(C)C)C1)C(=O)COc1c(C)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H38F3N3O7/c1-6-14-45-27(41)16-25(26(40)18-46-29-19(2)22(34)15-23(35)28(29)36)38-30(42)20-10-9-13-39(17-20)32(44)31(43)37-24-12-8-7-11-21(24)33(3,4)5/h6-8,11-12,15,20,25H,1,9-10,13-14,16-18H2,2-5H3,(H,37,43)(H,38,42)/t20-,25+/m1/s1 |
| InChIKey | BIZLHZMALRCIFM-NLFFAJNJSA-N |
| XLogP | 4.14 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|