C29H30ClF3N2O7 — CID 138480328
(2-chlorophenyl) (3S)-3-[[(3S)-1,4-dioxo-1-prop-2-enoxy-5-(2,3,5-trifluoro-6-methylphenoxy)pentan-3-yl]carbamoyl]azepane-1-carboxylate (PubChem CID 138480328) has the molecular formula C29H30ClF3N2O7 and a molecular weight of 611.01 g/mol. Its IUPAC name is (2-chlorophenyl) (3S)-3-[[(3S)-1,4-dioxo-1-prop-2-enoxy-5-(2,3,5-trifluoro-6-methylphenoxy)pentan-3-yl]carbamoyl]azepane-1-carboxylate.
| Compound Name | (2-chlorophenyl) (3S)-3-[[(3S)-1,4-dioxo-1-prop-2-enoxy-5-(2,3,5-trifluoro-6-methylphenoxy)pentan-3-yl]carbamoyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 138480328 |
| Molecular Formula | C29H30ClF3N2O7 |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | (2-chlorophenyl) (3S)-3-[[(3S)-1,4-dioxo-1-prop-2-enoxy-5-(2,3,5-trifluoro-6-methylphenoxy)pentan-3-yl]carbamoyl]azepane-1-carboxylate |
| SMILES | C=CCOC(=O)C[C@H](NC(=O)[C@H]1CCCCN(C(=O)Oc2ccccc2Cl)C1)C(=O)COc1c(C)c(F)cc(F)c1F |
| InChI | InChI=1S/C29H30ClF3N2O7/c1-3-12-40-25(37)14-22(23(36)16-41-27-17(2)20(31)13-21(32)26(27)33)34-28(38)18-8-6-7-11-35(15-18)29(39)42-24-10-5-4-9-19(24)30/h3-5,9-10,13,18,22H,1,6-8,11-12,14-16H2,2H3,(H,34,38)/t18-,22-/m0/s1 |
| InChIKey | CCPIQELXLAJWMJ-AVRDEDQJSA-N |
| XLogP | 4.92 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|