C21H21F4N3O3 — CID 135376448
N-[1-(6-amino-3-pyridinyl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]cyclopentanecarboxamide (PubChem CID 135376448) has the molecular formula C21H21F4N3O3 and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[1-(6-amino-3-pyridinyl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]cyclopentanecarboxamide.
| Compound Name | N-[1-(6-amino-3-pyridinyl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 135376448 |
| Molecular Formula | C21H21F4N3O3 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[1-(6-amino-3-pyridinyl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]cyclopentanecarboxamide |
| SMILES | Nc1ccc(CC(NC(=O)C2CCCC2)C(=O)COc2c(F)c(F)cc(F)c2F)cn1 |
| InChI | InChI=1S/C21H21F4N3O3/c22-13-8-14(23)19(25)20(18(13)24)31-10-16(29)15(7-11-5-6-17(26)27-9-11)28-21(30)12-3-1-2-4-12/h5-6,8-9,12,15H,1-4,7,10H2,(H2,26,27)(H,28,30) |
| InChIKey | LNRQWIKHDMFEPQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|