C20H28F2N2O3 — CID 157151077
N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide (PubChem CID 157151077) has the molecular formula C20H28F2N2O3 and a molecular weight of 382.45 g/mol. Its IUPAC name is N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 157151077 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
| SMILES | Cc1ccc(F)c(OCC(=O)C(CCCCN)NC(=O)C2CCCC2)c1F |
| InChI | InChI=1S/C20H28F2N2O3/c1-13-9-10-15(21)19(18(13)22)27-12-17(25)16(8-4-5-11-23)24-20(26)14-6-2-3-7-14/h9-10,14,16H,2-8,11-12,23H2,1H3,(H,24,26) |
| InChIKey | GSZATWBQDUPXSO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|