C21H24F6N2O5 — CID 138733385
[1-[[7-amino-2-oxo-1-(2,3,6-trifluorophenoxy)heptan-3-yl]carbamoyl]cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 138733385) has the molecular formula C21H24F6N2O5 and a molecular weight of 498.42 g/mol. Its IUPAC name is [1-[[7-amino-2-oxo-1-(2,3,6-trifluorophenoxy)heptan-3-yl]carbamoyl]cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[[7-amino-2-oxo-1-(2,3,6-trifluorophenoxy)heptan-3-yl]carbamoyl]cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 138733385 |
| Molecular Formula | C21H24F6N2O5 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [1-[[7-amino-2-oxo-1-(2,3,6-trifluorophenoxy)heptan-3-yl]carbamoyl]cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | NCCCCC(NC(=O)C1(OC(=O)C(F)(F)F)CCCC1)C(=O)COc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C21H24F6N2O5/c22-12-6-7-13(23)17(16(12)24)33-11-15(30)14(5-1-4-10-28)29-18(31)20(8-2-3-9-20)34-19(32)21(25,26)27/h6-7,14H,1-5,8-11,28H2,(H,29,31) |
| InChIKey | AETHPOLKHFTZEM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|