C23H30F3N3O5S — CID 121250185
N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-methoxycyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 121250185) has the molecular formula C23H30F3N3O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-methoxycyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-methoxycyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 121250185 |
| Molecular Formula | C23H30F3N3O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-methoxycyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COC1(C(=O)N[C@@H](CCCCN)C(=O)c2nc3ccccc3s2)CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29N3O3S.C2HF3O2/c1-27-21(12-6-2-7-13-21)20(26)24-16(10-5-8-14-22)18(25)19-23-15-9-3-4-11-17(15)28-19;3-2(4,5)1(6)7/h3-4,9,11,16H,2,5-8,10,12-14,22H2,1H3,(H,24,26);(H,6,7)/t16-;/m0./s1 |
| InChIKey | DAHDYSDRVRIGDO-NTISSMGPSA-N |
| XLogP | 4.08 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|