About N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide
N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide (PubChem CID 121262727) has the molecular formula C21H28N2O2S
and a molecular weight of 372.53 g/mol. Its IUPAC name is N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide |
| PubChem CID | 121262727 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide |
| SMILES | CCCCC[C@H](NC(=O)C1CCCCC1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H28N2O2S/c1-2-3-5-13-17(22-20(25)15-10-6-4-7-11-15)19(24)21-23-16-12-8-9-14-18(16)26-21/h8-9,12,14-15,17H,2-7,10-11,13H2,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | PATUXOVBIGYTOD-KRWDZBQOSA-N |
| XLogP | 5.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide?
The IUPAC name of N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide (CID 121262727) is N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide is CCCCC[C@H](NC(=O)C1CCCCC1)C(=O)c1nc2ccccc2s1.
What is the InChIKey of N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide?
The InChIKey is PATUXOVBIGYTOD-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H28N2O2S/c1-2-3-5-13-17(22-20(25)15-10-6-4-7-11-15)19(24)21-23-16-12-8-9-14-18(16)26-21/h8-9,12,14-15,17H,2-7,10-11,13H2,1H3,(H,22,25)/t17-/m0/s1.
What are the key properties of N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide?
N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide has a molecular weight of 372.53 g/mol, XLogP of 5.12, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]cyclohexanecarboxamide is sourced from PubChem (CID 121262727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).