C36H40N4O5S — CID 121250165
benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-1-(3-phenylpropanoyl)piperidine-3-carbonyl]amino]hexyl]carbamate (PubChem CID 121250165) has the molecular formula C36H40N4O5S and a molecular weight of 640.81 g/mol. Its IUPAC name is benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-1-(3-phenylpropanoyl)piperidine-3-carbonyl]amino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-1-(3-phenylpropanoyl)piperidine-3-carbonyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 121250165 |
| Molecular Formula | C36H40N4O5S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-1-(3-phenylpropanoyl)piperidine-3-carbonyl]amino]hexyl]carbamate |
| SMILES | O=C(NCCCC[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCc2ccccc2)C1)C(=O)c1nc2ccccc2s1)OCc1ccccc1 |
| InChI | InChI=1S/C36H40N4O5S/c41-32(21-20-26-12-3-1-4-13-26)40-23-11-16-28(24-40)34(43)38-30(33(42)35-39-29-17-7-8-19-31(29)46-35)18-9-10-22-37-36(44)45-25-27-14-5-2-6-15-27/h1-8,12-15,17,19,28,30H,9-11,16,18,20-25H2,(H,37,44)(H,38,43)/t28-,30+/m1/s1 |
| InChIKey | XXOXJHUNNXSUMP-DGPALRBDSA-N |
| XLogP | 5.93 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|