C23H29F3N4O5S — CID 154956702
(3R)-1-acetyl-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154956702) has the molecular formula C23H29F3N4O5S and a molecular weight of 530.57 g/mol. Its IUPAC name is (3R)-1-acetyl-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R)-1-acetyl-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154956702 |
| Molecular Formula | C23H29F3N4O5S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (3R)-1-acetyl-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N1CCC[C@@H](C(=O)NC(CCCCN)C(=O)c2nc3ccccc3s2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N4O3S.C2HF3O2/c1-14(26)25-12-6-7-15(13-25)20(28)23-17(9-4-5-11-22)19(27)21-24-16-8-2-3-10-18(16)29-21;3-2(4,5)1(6)7/h2-3,8,10,15,17H,4-7,9,11-13,22H2,1H3,(H,23,28);(H,6,7)/t15-,17?;/m1./s1 |
| InChIKey | YKGQMGZLAKTRRP-GKDMBGIGSA-N |
| XLogP | 2.98 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|