C18H24N4O3S — CID 22888610
N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 22888610) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22888610 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | NCCCCC(NC(=O)C1CC(O)CN1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H24N4O3S/c19-8-4-3-6-13(21-17(25)14-9-11(23)10-20-14)16(24)18-22-12-5-1-2-7-15(12)26-18/h1-2,5,7,11,13-14,20,23H,3-4,6,8-10,19H2,(H,21,25) |
| InChIKey | VHMNTOZELNCNMV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|