C27H31N3O4S — CID 174986386
benzyl N-[6-(1,3-benzothiazol-2-yl)-5-(cyclopentanecarbonylamino)-6-oxohexyl]carbamate (PubChem CID 174986386) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is benzyl N-[6-(1,3-benzothiazol-2-yl)-5-(cyclopentanecarbonylamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[6-(1,3-benzothiazol-2-yl)-5-(cyclopentanecarbonylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 174986386 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | benzyl N-[6-(1,3-benzothiazol-2-yl)-5-(cyclopentanecarbonylamino)-6-oxohexyl]carbamate |
| SMILES | O=C(NCCCCC(NC(=O)C1CCCC1)C(=O)c1nc2ccccc2s1)OCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O4S/c31-24(26-30-21-14-6-7-16-23(21)35-26)22(29-25(32)20-12-4-5-13-20)15-8-9-17-28-27(33)34-18-19-10-2-1-3-11-19/h1-3,6-7,10-11,14,16,20,22H,4-5,8-9,12-13,15,17-18H2,(H,28,33)(H,29,32) |
| InChIKey | WRIHEVKGPLWCCA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|