C26H30N4O4S — CID 11605650
benzyl N-[(2S)-6-amino-1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate (PubChem CID 11605650) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is benzyl N-[(2S)-6-amino-1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-6-amino-1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 11605650 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | benzyl N-[(2S)-6-amino-1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H30N4O4S/c27-15-7-6-12-20(29-26(33)34-17-18-9-2-1-3-10-18)25(32)30-16-8-13-21(30)23(31)24-28-19-11-4-5-14-22(19)35-24/h1-5,9-11,14,20-21H,6-8,12-13,15-17,27H2,(H,29,33)/t20-,21-/m0/s1 |
| InChIKey | GKCPVFWFWNLVTJ-SFTDATJTSA-N |
| XLogP | 3.89 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|