C17H25FN4O3 — CID 134347880
N-[(3S)-7-amino-1-(5-fluoro-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide (PubChem CID 134347880) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-[(3S)-7-amino-1-(5-fluoro-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[(3S)-7-amino-1-(5-fluoro-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 134347880 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[(3S)-7-amino-1-(5-fluoro-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
| SMILES | NCCCC[C@H](NC(=O)C1CCCC1)C(=O)Cn1cncc(F)c1=O |
| InChI | InChI=1S/C17H25FN4O3/c18-13-9-20-11-22(17(13)25)10-15(23)14(7-3-4-8-19)21-16(24)12-5-1-2-6-12/h9,11-12,14H,1-8,10,19H2,(H,21,24)/t14-/m0/s1 |
| InChIKey | HGJPFFXPUBCNGY-AWEZNQCLSA-N |
| XLogP | 0.76 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|