C18H29Cl3N4O2 — CID 119856460
1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide;dihydrochloride (PubChem CID 119856460) has the molecular formula C18H29Cl3N4O2 and a molecular weight of 439.82 g/mol. Its IUPAC name is 1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide;dihydrochloride.
| Compound Name | 1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119856460 |
| Molecular Formula | C18H29Cl3N4O2 |
| Molecular Weight | 439.82 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)N1CCCC(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C18H27ClN4O2.2ClH/c19-15-8-9-16(21-12-15)22-18(25)14-6-5-11-23(13-14)17(24)7-3-1-2-4-10-20;;/h8-9,12,14H,1-7,10-11,13,20H2,(H,21,22,25);2*1H |
| InChIKey | ZLUANQKLTFMKLM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|