C18H28N4O3 — CID 158713063
N-[7-amino-1-(5-methyl-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide (PubChem CID 158713063) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[7-amino-1-(5-methyl-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[7-amino-1-(5-methyl-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 158713063 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[7-amino-1-(5-methyl-6-oxopyrimidin-1-yl)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
| SMILES | Cc1cncn(CC(=O)C(CCCCN)NC(=O)C2CCCC2)c1=O |
| InChI | InChI=1S/C18H28N4O3/c1-13-10-20-12-22(18(13)25)11-16(23)15(8-4-5-9-19)21-17(24)14-6-2-3-7-14/h10,12,14-15H,2-9,11,19H2,1H3,(H,21,24) |
| InChIKey | DZAQCVCLHLEMJF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|