C30H31F3N4O6 — CID 145399217
prop-2-enyl (3S)-3-[[1-(1-methylbenzimidazole-2-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate (PubChem CID 145399217) has the molecular formula C30H31F3N4O6 and a molecular weight of 600.59 g/mol. Its IUPAC name is prop-2-enyl (3S)-3-[[1-(1-methylbenzimidazole-2-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate.
| Compound Name | prop-2-enyl (3S)-3-[[1-(1-methylbenzimidazole-2-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate |
|---|---|
| PubChem CID | 145399217 |
| Molecular Formula | C30H31F3N4O6 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | prop-2-enyl (3S)-3-[[1-(1-methylbenzimidazole-2-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5-trifluoro-6-methylphenoxy)pentanoate |
| SMILES | C=CCOC(=O)C[C@H](NC(=O)C1CCN(C(=O)c2nc3ccccc3n2C)CC1)C(=O)COc1c(C)c(F)cc(F)c1F |
| InChI | InChI=1S/C30H31F3N4O6/c1-4-13-42-25(39)15-22(24(38)16-43-27-17(2)19(31)14-20(32)26(27)33)35-29(40)18-9-11-37(12-10-18)30(41)28-34-21-7-5-6-8-23(21)36(28)3/h4-8,14,18,22H,1,9-13,15-16H2,2-3H3,(H,35,40)/t22-/m0/s1 |
| InChIKey | KKTBRLPYDAHVTK-QFIPXVFZSA-N |
| XLogP | 3.40 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|