C22H22F3N3O7 — CID 160745306
(3S)-3-[[1-(1,2-oxazole-3-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid (PubChem CID 160745306) has the molecular formula C22H22F3N3O7 and a molecular weight of 497.43 g/mol. Its IUPAC name is (3S)-3-[[1-(1,2-oxazole-3-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[1-(1,2-oxazole-3-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 160745306 |
| Molecular Formula | C22H22F3N3O7 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (3S)-3-[[1-(1,2-oxazole-3-carbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid |
| SMILES | Cc1cc(F)c(F)c(OCC(=O)[C@H](CC(=O)O)NC(=O)C2CCN(C(=O)c3ccon3)CC2)c1F |
| InChI | InChI=1S/C22H22F3N3O7/c1-11-8-13(23)19(25)20(18(11)24)34-10-16(29)15(9-17(30)31)26-21(32)12-2-5-28(6-3-12)22(33)14-4-7-35-27-14/h4,7-8,12,15H,2-3,5-6,9-10H2,1H3,(H,26,32)(H,30,31)/t15-/m0/s1 |
| InChIKey | RZTCKVUZMQJXJW-HNNXBMFYSA-N |
| XLogP | 1.86 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|