C28H36F3N3O7 — CID 138480227
(3S)-3-[[1-[2-(2-cyclopentylethylamino)-2-oxoacetyl]azepane-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid (PubChem CID 138480227) has the molecular formula C28H36F3N3O7 and a molecular weight of 583.60 g/mol. Its IUPAC name is (3S)-3-[[1-[2-(2-cyclopentylethylamino)-2-oxoacetyl]azepane-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[1-[2-(2-cyclopentylethylamino)-2-oxoacetyl]azepane-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480227 |
| Molecular Formula | C28H36F3N3O7 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | (3S)-3-[[1-[2-(2-cyclopentylethylamino)-2-oxoacetyl]azepane-4-carbonyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid |
| SMILES | Cc1cc(F)c(F)c(OCC(=O)[C@H](CC(=O)O)NC(=O)C2CCCN(C(=O)C(=O)NCCC3CCCC3)CC2)c1F |
| InChI | InChI=1S/C28H36F3N3O7/c1-16-13-19(29)24(31)25(23(16)30)41-15-21(35)20(14-22(36)37)33-26(38)18-7-4-11-34(12-9-18)28(40)27(39)32-10-8-17-5-2-3-6-17/h13,17-18,20H,2-12,14-15H2,1H3,(H,32,39)(H,33,38)(H,36,37)/t18?,20-/m0/s1 |
| InChIKey | HAHNFLRVWDRSHA-IJHRGXPZSA-N |
| XLogP | 2.64 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|