C30H33F4N3O7 — CID 138617100
(4S)-4-[[(3S)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid (PubChem CID 138617100) has the molecular formula C30H33F4N3O7 and a molecular weight of 623.60 g/mol. Its IUPAC name is (4S)-4-[[(3S)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid.
| Compound Name | (4S)-4-[[(3S)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid |
|---|---|
| PubChem CID | 138617100 |
| Molecular Formula | C30H33F4N3O7 |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | (4S)-4-[[(3S)-1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-3-carbonyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C(=O)N1CCC[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)COc2c(F)c(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C30H33F4N3O7/c1-30(2,3)17-8-4-5-9-20(17)35-28(42)29(43)37-12-6-7-16(14-37)27(41)36-21(10-11-23(39)40)22(38)15-44-26-24(33)18(31)13-19(32)25(26)34/h4-5,8-9,13,16,21H,6-7,10-12,14-15H2,1-3H3,(H,35,42)(H,36,41)(H,39,40)/t16-,21-/m0/s1 |
| InChIKey | OOFVIFRCSQOHTG-KKSFZXQISA-N |
| XLogP | 3.72 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|