C30H32F4N2O8 — CID 159728870
(3S)-3-[[(2R)-4-[3-(2-tert-butylphenyl)-2-oxopropanoyl]-1,4-oxazepane-2-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 159728870) has the molecular formula C30H32F4N2O8 and a molecular weight of 624.58 g/mol. Its IUPAC name is (3S)-3-[[(2R)-4-[3-(2-tert-butylphenyl)-2-oxopropanoyl]-1,4-oxazepane-2-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[(2R)-4-[3-(2-tert-butylphenyl)-2-oxopropanoyl]-1,4-oxazepane-2-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 159728870 |
| Molecular Formula | C30H32F4N2O8 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | (3S)-3-[[(2R)-4-[3-(2-tert-butylphenyl)-2-oxopropanoyl]-1,4-oxazepane-2-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)(C)c1ccccc1CC(=O)C(=O)N1CCCO[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)COc2c(F)c(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C30H32F4N2O8/c1-30(2,3)17-8-5-4-7-16(17)11-21(37)29(42)36-9-6-10-43-23(14-36)28(41)35-20(13-24(39)40)22(38)15-44-27-25(33)18(31)12-19(32)26(27)34/h4-5,7-8,12,20,23H,6,9-11,13-15H2,1-3H3,(H,35,41)(H,39,40)/t20-,23+/m0/s1 |
| InChIKey | NAZGEGBSDOGJOX-NZQKXSOJSA-N |
| XLogP | 2.88 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|