C33H41F4N3O8 — CID 138480219
tert-butyl (3S)-3-[[4-[2-(2-tert-butylanilino)-2-oxoacetyl]-1,4-oxazepane-6-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 138480219) has the molecular formula C33H41F4N3O8 and a molecular weight of 683.70 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[2-(2-tert-butylanilino)-2-oxoacetyl]-1,4-oxazepane-6-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl (3S)-3-[[4-[2-(2-tert-butylanilino)-2-oxoacetyl]-1,4-oxazepane-6-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 138480219 |
| Molecular Formula | C33H41F4N3O8 |
| Molecular Weight | 683.70 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[2-(2-tert-butylanilino)-2-oxoacetyl]-1,4-oxazepane-6-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)C1COCCN(C(=O)C(=O)Nc2ccccc2C(C)(C)C)C1)C(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H41F4N3O8/c1-32(2,3)19-9-7-8-10-22(19)38-30(44)31(45)40-11-12-46-16-18(15-40)29(43)39-23(14-25(42)48-33(4,5)6)24(41)17-47-28-26(36)20(34)13-21(35)27(28)37/h7-10,13,18,23-24,41H,11-12,14-17H2,1-6H3,(H,38,44)(H,39,43)/t18?,23-,24?/m0/s1 |
| InChIKey | VVKSAXQUTRSBAO-IMBKEICKSA-N |
| XLogP | 3.61 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|