C21H25F3N2O7 — CID 160685545
(3S)-3-[(1-ethoxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid (PubChem CID 160685545) has the molecular formula C21H25F3N2O7 and a molecular weight of 474.43 g/mol. Its IUPAC name is (3S)-3-[(1-ethoxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid.
| Compound Name | (3S)-3-[(1-ethoxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 160685545 |
| Molecular Formula | C21H25F3N2O7 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (3S)-3-[(1-ethoxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,6-trifluoro-5-methylphenoxy)pentanoic acid |
| SMILES | CCOC(=O)N1CCC(C(=O)N[C@@H](CC(=O)O)C(=O)COc2c(F)c(C)cc(F)c2F)CC1 |
| InChI | InChI=1S/C21H25F3N2O7/c1-3-32-21(31)26-6-4-12(5-7-26)20(30)25-14(9-16(28)29)15(27)10-33-19-17(23)11(2)8-13(22)18(19)24/h8,12,14H,3-7,9-10H2,1-2H3,(H,25,30)(H,28,29)/t14-/m0/s1 |
| InChIKey | YJMRZYVZIAIIEV-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|