C12H9F4NO4 — CID 138480237
N-[2,5-dioxo-1-(2,3,5,6-tetrafluorophenoxy)pentan-3-yl]formamide (PubChem CID 138480237) has the molecular formula C12H9F4NO4 and a molecular weight of 307.20 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(2,3,5,6-tetrafluorophenoxy)pentan-3-yl]formamide.
| Compound Name | N-[2,5-dioxo-1-(2,3,5,6-tetrafluorophenoxy)pentan-3-yl]formamide |
|---|---|
| PubChem CID | 138480237 |
| Molecular Formula | C12H9F4NO4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-[2,5-dioxo-1-(2,3,5,6-tetrafluorophenoxy)pentan-3-yl]formamide |
| SMILES | O=CCC(NC=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H9F4NO4/c13-6-3-7(14)11(16)12(10(6)15)21-4-9(20)8(1-2-18)17-5-19/h2-3,5,8H,1,4H2,(H,17,19) |
| InChIKey | HDTUPLFZNCVGGT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|