C13H13F4NO4 — CID 155090138
5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid (PubChem CID 155090138) has the molecular formula C13H13F4NO4 and a molecular weight of 323.24 g/mol. Its IUPAC name is 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid.
| Compound Name | 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid |
|---|---|
| PubChem CID | 155090138 |
| Molecular Formula | C13H13F4NO4 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid |
| SMILES | NC(CCCC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H13F4NO4/c14-6-4-7(15)12(17)13(11(6)16)22-5-9(19)8(18)2-1-3-10(20)21/h4,8H,1-3,5,18H2,(H,20,21) |
| InChIKey | HAXGPEVVJDGTTC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|