5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid

C13H13F4NO4 — CID 155090138

IUPAC5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid
SMILESNC(CCCC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F
InChIInChI=1S/C13H13F4NO4/c14-6-4-7(15)12(17)13(11(6)16)22-5-9(19)8(18)2-1-3-10(20)21/h4,8H,1-3,5,18H2,(H,20,21)
InChIKeyHAXGPEVVJDGTTC-UHFFFAOYSA-N
MW323.24 g/mol
LogP1.77
Rot. Bonds8

About 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid

5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid (PubChem CID 155090138) has the molecular formula C13H13F4NO4 and a molecular weight of 323.24 g/mol. Its IUPAC name is 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid.

Molecular Properties

Compound Name5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid
PubChem CID155090138
Molecular FormulaC13H13F4NO4
Molecular Weight323.24 g/mol
Exact Mass323.08
IUPAC Name5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid
SMILESNC(CCCC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F
InChIInChI=1S/C13H13F4NO4/c14-6-4-7(15)12(17)13(11(6)16)22-5-9(19)8(18)2-1-3-10(20)21/h4,8H,1-3,5,18H2,(H,20,21)
InChIKeyHAXGPEVVJDGTTC-UHFFFAOYSA-N
XLogP1.77
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.24
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid?
The IUPAC name of 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid (CID 155090138) is 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid.
What is the SMILES notation for 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid?
The canonical SMILES for 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid is NC(CCCC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F.
What is the InChIKey of 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid?
The InChIKey is HAXGPEVVJDGTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F4NO4/c14-6-4-7(15)12(17)13(11(6)16)22-5-9(19)8(18)2-1-3-10(20)21/h4,8H,1-3,5,18H2,(H,20,21).
What are the key properties of 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid?
5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid has a molecular weight of 323.24 g/mol, XLogP of 1.77, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid is sourced from PubChem (CID 155090138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).