C18H16ClF4NO3 — CID 155090189
(3S)-3-amino-5-[(4-chlorophenyl)methoxy]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one (PubChem CID 155090189) has the molecular formula C18H16ClF4NO3 and a molecular weight of 405.78 g/mol. Its IUPAC name is (3S)-3-amino-5-[(4-chlorophenyl)methoxy]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one.
| Compound Name | (3S)-3-amino-5-[(4-chlorophenyl)methoxy]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one |
|---|---|
| PubChem CID | 155090189 |
| Molecular Formula | C18H16ClF4NO3 |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (3S)-3-amino-5-[(4-chlorophenyl)methoxy]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one |
| SMILES | N[C@@H](CCOCc1ccc(Cl)cc1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C18H16ClF4NO3/c19-11-3-1-10(2-4-11)8-26-6-5-14(24)15(25)9-27-18-16(22)12(20)7-13(21)17(18)23/h1-4,7,14H,5-6,8-9,24H2/t14-/m0/s1 |
| InChIKey | HXGUUHHSUQVRLX-AWEZNQCLSA-N |
| XLogP | 3.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|