C14H14F4N2O3 — CID 175537606
(3S)-3-[2-amino-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butyl]pyrrolidin-2-one (PubChem CID 175537606) has the molecular formula C14H14F4N2O3 and a molecular weight of 334.27 g/mol. Its IUPAC name is (3S)-3-[2-amino-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butyl]pyrrolidin-2-one.
| Compound Name | (3S)-3-[2-amino-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 175537606 |
| Molecular Formula | C14H14F4N2O3 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (3S)-3-[2-amino-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butyl]pyrrolidin-2-one |
| SMILES | NC(C[C@@H]1CCNC1=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H14F4N2O3/c15-7-4-8(16)12(18)13(11(7)17)23-5-10(21)9(19)3-6-1-2-20-14(6)22/h4,6,9H,1-3,5,19H2,(H,20,22)/t6-,9?/m0/s1 |
| InChIKey | BAWFUWSTPBEYHJ-AADKRJSRSA-N |
| XLogP | 1.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|