C21H26F4N2O4 — CID 167333886
(3R,6S)-6-amino-8-methyl-3-[[(3R)-2-oxopyrrolidin-3-yl]methyl]-1-(2,3,5,6-tetrafluorophenoxy)nonane-2,5-dione (PubChem CID 167333886) has the molecular formula C21H26F4N2O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is (3R,6S)-6-amino-8-methyl-3-[[(3R)-2-oxopyrrolidin-3-yl]methyl]-1-(2,3,5,6-tetrafluorophenoxy)nonane-2,5-dione.
| Compound Name | (3R,6S)-6-amino-8-methyl-3-[[(3R)-2-oxopyrrolidin-3-yl]methyl]-1-(2,3,5,6-tetrafluorophenoxy)nonane-2,5-dione |
|---|---|
| PubChem CID | 167333886 |
| Molecular Formula | C21H26F4N2O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3R,6S)-6-amino-8-methyl-3-[[(3R)-2-oxopyrrolidin-3-yl]methyl]-1-(2,3,5,6-tetrafluorophenoxy)nonane-2,5-dione |
| SMILES | CC(C)C[C@H](N)C(=O)CC(C[C@@H]1CCNC1=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H26F4N2O4/c1-10(2)5-15(26)16(28)7-12(6-11-3-4-27-21(11)30)17(29)9-31-20-18(24)13(22)8-14(23)19(20)25/h8,10-12,15H,3-7,9,26H2,1-2H3,(H,27,30)/t11-,12?,15-/m0/s1 |
| InChIKey | IEVVUMXBIFNMJU-BQELKBSMSA-N |
| XLogP | 2.67 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|