C18H16F4N2O5 — CID 167333856
3-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]pyrrolidine-2,5-dione (PubChem CID 167333856) has the molecular formula C18H16F4N2O5 and a molecular weight of 416.33 g/mol. Its IUPAC name is 3-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167333856 |
| Molecular Formula | C18H16F4N2O5 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 3-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC([C@H](C[C@H]2CCNC2=O)C(=O)COc2c(F)c(F)cc(F)c2F)C(=O)N1 |
| InChI | InChI=1S/C18H16F4N2O5/c19-10-5-11(20)15(22)16(14(10)21)29-6-12(25)8(3-7-1-2-23-17(7)27)9-4-13(26)24-18(9)28/h5,7-9H,1-4,6H2,(H,23,27)(H,24,26,28)/t7-,8+,9?/m1/s1 |
| InChIKey | VCVHBODWZPALEE-WGTSGOJVSA-N |
| XLogP | 1.00 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|