C20H23N2O4P — CID 175537656
(3S)-3-(2-amino-4-diphenylphosphoryloxy-3-oxobutyl)pyrrolidin-2-one (PubChem CID 175537656) has the molecular formula C20H23N2O4P and a molecular weight of 386.39 g/mol. Its IUPAC name is (3S)-3-(2-amino-4-diphenylphosphoryloxy-3-oxobutyl)pyrrolidin-2-one.
| Compound Name | (3S)-3-(2-amino-4-diphenylphosphoryloxy-3-oxobutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 175537656 |
| Molecular Formula | C20H23N2O4P |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (3S)-3-(2-amino-4-diphenylphosphoryloxy-3-oxobutyl)pyrrolidin-2-one |
| SMILES | NC(C[C@@H]1CCNC1=O)C(=O)COP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N2O4P/c21-18(13-15-11-12-22-20(15)24)19(23)14-26-27(25,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,18H,11-14,21H2,(H,22,24)/t15-,18?/m0/s1 |
| InChIKey | FJMCRUAMIHLUQB-BUSXIPJBSA-N |
| XLogP | 1.35 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|