C16H20N2O3 — CID 170051086
benzyl (E,4S)-4-amino-5-(2-oxopyrrolidin-3-yl)pent-2-enoate (PubChem CID 170051086) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is benzyl (E,4S)-4-amino-5-(2-oxopyrrolidin-3-yl)pent-2-enoate.
| Compound Name | benzyl (E,4S)-4-amino-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 170051086 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | benzyl (E,4S)-4-amino-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
| SMILES | N[C@H](/C=C/C(=O)OCc1ccccc1)CC1CCNC1=O |
| InChI | InChI=1S/C16H20N2O3/c17-14(10-13-8-9-18-16(13)20)6-7-15(19)21-11-12-4-2-1-3-5-12/h1-7,13-14H,8-11,17H2,(H,18,20)/b7-6+/t13?,14-/m1/s1 |
| InChIKey | ITDYMJILSXUPDJ-VPPMGHBHSA-N |
| XLogP | 1.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|