C17H23N3O7S — CID 162685345
1-hydroxy-3-(2-oxopyrrolidin-3-yl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propane-1-sulfinic acid (PubChem CID 162685345) has the molecular formula C17H23N3O7S and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-hydroxy-3-(2-oxopyrrolidin-3-yl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propane-1-sulfinic acid.
| Compound Name | 1-hydroxy-3-(2-oxopyrrolidin-3-yl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 162685345 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-hydroxy-3-(2-oxopyrrolidin-3-yl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propane-1-sulfinic acid |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NC(CC1CCNC1=O)C(O)S(=O)O |
| InChI | InChI=1S/C17H23N3O7S/c21-14(9-19-17(24)27-10-11-4-2-1-3-5-11)20-13(16(23)28(25)26)8-12-6-7-18-15(12)22/h1-5,12-13,16,23H,6-10H2,(H,18,22)(H,19,24)(H,20,21)(H,25,26) |
| InChIKey | MNHSBGULZBGVFX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|