C15H21N2O4P — CID 166170344
(3S)-3-[(2S)-2-amino-4-[methyl(phenyl)phosphoryl]oxy-3-oxobutyl]pyrrolidin-2-one (PubChem CID 166170344) has the molecular formula C15H21N2O4P and a molecular weight of 324.32 g/mol. Its IUPAC name is (3S)-3-[(2S)-2-amino-4-[methyl(phenyl)phosphoryl]oxy-3-oxobutyl]pyrrolidin-2-one.
| Compound Name | (3S)-3-[(2S)-2-amino-4-[methyl(phenyl)phosphoryl]oxy-3-oxobutyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 166170344 |
| Molecular Formula | C15H21N2O4P |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (3S)-3-[(2S)-2-amino-4-[methyl(phenyl)phosphoryl]oxy-3-oxobutyl]pyrrolidin-2-one |
| SMILES | CP(=O)(OCC(=O)[C@@H](N)C[C@@H]1CCNC1=O)c1ccccc1 |
| InChI | InChI=1S/C15H21N2O4P/c1-22(20,12-5-3-2-4-6-12)21-10-14(18)13(16)9-11-7-8-17-15(11)19/h2-6,11,13H,7-10,16H2,1H3,(H,17,19)/t11-,13-,22?/m0/s1 |
| InChIKey | ASZNJZJRWKJCEU-UNVMKQBOSA-N |
| XLogP | 0.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|