C8H13ClN2O2 — CID 143139104
(3S)-3-(2-amino-4-chloro-3-oxobutyl)pyrrolidin-2-one (PubChem CID 143139104) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is (3S)-3-(2-amino-4-chloro-3-oxobutyl)pyrrolidin-2-one.
| Compound Name | (3S)-3-(2-amino-4-chloro-3-oxobutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 143139104 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (3S)-3-(2-amino-4-chloro-3-oxobutyl)pyrrolidin-2-one |
| SMILES | NC(C[C@@H]1CCNC1=O)C(=O)CCl |
| InChI | InChI=1S/C8H13ClN2O2/c9-4-7(12)6(10)3-5-1-2-11-8(5)13/h5-6H,1-4,10H2,(H,11,13)/t5-,6?/m0/s1 |
| InChIKey | SZRUTPQIPWMIRX-ZBHICJROSA-N |
| XLogP | -0.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|