C15H25Cl2N3O3 — CID 170431093
2-amino-N-[4-chloro-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-3-cyclopropylpropanamide;hydrochloride (PubChem CID 170431093) has the molecular formula C15H25Cl2N3O3 and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-amino-N-[4-chloro-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-3-cyclopropylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[4-chloro-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-3-cyclopropylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 170431093 |
| Molecular Formula | C15H25Cl2N3O3 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-amino-N-[4-chloro-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-3-cyclopropylpropanamide;hydrochloride |
| SMILES | Cl.NC(CC1CC1)C(=O)NC(C[C@@H]1CCCNC1=O)C(=O)CCl |
| InChI | InChI=1S/C15H24ClN3O3.ClH/c16-8-13(20)12(7-10-2-1-5-18-14(10)21)19-15(22)11(17)6-9-3-4-9;/h9-12H,1-8,17H2,(H,18,21)(H,19,22);1H/t10-,11?,12?;/m0./s1 |
| InChIKey | XMUCWSWFOUKACC-YGKYINHESA-N |
| XLogP | 0.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|