C9H13ClN2O4 — CID 166744904
[4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamic acid (PubChem CID 166744904) has the molecular formula C9H13ClN2O4 and a molecular weight of 248.67 g/mol. Its IUPAC name is [4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamic acid.
| Compound Name | [4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 166744904 |
| Molecular Formula | C9H13ClN2O4 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | [4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(CC1CCNC1=O)C(=O)CCl |
| InChI | InChI=1S/C9H13ClN2O4/c10-4-7(13)6(12-9(15)16)3-5-1-2-11-8(5)14/h5-6,12H,1-4H2,(H,11,14)(H,15,16) |
| InChIKey | BDLJXVYQPZOFSV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|