C16H21N2O6P — CID 175537617
[(2S)-4-[methyl(phenyl)phosphoryl]oxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] carbamate (PubChem CID 175537617) has the molecular formula C16H21N2O6P and a molecular weight of 368.33 g/mol. Its IUPAC name is [(2S)-4-[methyl(phenyl)phosphoryl]oxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] carbamate.
| Compound Name | [(2S)-4-[methyl(phenyl)phosphoryl]oxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] carbamate |
|---|---|
| PubChem CID | 175537617 |
| Molecular Formula | C16H21N2O6P |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [(2S)-4-[methyl(phenyl)phosphoryl]oxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] carbamate |
| SMILES | CP(=O)(OCC(=O)[C@H](C[C@@H]1CCNC1=O)OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N2O6P/c1-25(22,12-5-3-2-4-6-12)23-10-13(19)14(24-16(17)21)9-11-7-8-18-15(11)20/h2-6,11,14H,7-10H2,1H3,(H2,17,21)(H,18,20)/t11-,14-,25?/m0/s1 |
| InChIKey | LEMDVQJPGYGPKA-ZEINVVOZSA-N |
| XLogP | 0.80 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|