C11H15F3N2O5 — CID 175537571
[3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethoxy)butan-2-yl] carbamate (PubChem CID 175537571) has the molecular formula C11H15F3N2O5 and a molecular weight of 312.24 g/mol. Its IUPAC name is [3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethoxy)butan-2-yl] carbamate.
| Compound Name | [3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethoxy)butan-2-yl] carbamate |
|---|---|
| PubChem CID | 175537571 |
| Molecular Formula | C11H15F3N2O5 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [3-oxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethoxy)butan-2-yl] carbamate |
| SMILES | NC(=O)OC(C[C@@H]1CCCNC1=O)C(=O)COC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O5/c12-11(13,14)20-5-7(17)8(21-10(15)19)4-6-2-1-3-16-9(6)18/h6,8H,1-5H2,(H2,15,19)(H,16,18)/t6-,8?/m0/s1 |
| InChIKey | ZERNAOYXRUXBDW-UUEFVBAFSA-N |
| XLogP | 0.47 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |