C18H26F3N3O4 — CID 167333819
1-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 167333819) has the molecular formula C18H26F3N3O4 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 167333819 |
| Molecular Formula | C18H26F3N3O4 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | NC(=O)C1CC2CCCCC2N1[C@@H](C[C@@H]1CCNC1=O)C(=O)COC(F)(F)F |
| InChI | InChI=1S/C18H26F3N3O4/c19-18(20,21)28-9-15(25)13(8-11-5-6-23-17(11)27)24-12-4-2-1-3-10(12)7-14(24)16(22)26/h10-14H,1-9H2,(H2,22,26)(H,23,27)/t10?,11-,12?,13-,14?/m0/s1 |
| InChIKey | FKNPJHSBABHILB-DHUKMVCYSA-N |
| XLogP | 1.11 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |