C16H22F3N3O5 — CID 167333931
2-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 167333931) has the molecular formula C16H22F3N3O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 167333931 |
| Molecular Formula | C16H22F3N3O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | NC(=O)C1CC2OC([C@H](C[C@H]3CCNC3=O)C(=O)COC(F)(F)F)CC2N1 |
| InChI | InChI=1S/C16H22F3N3O5/c17-16(18,19)26-6-11(23)8(3-7-1-2-21-15(7)25)12-4-9-13(27-12)5-10(22-9)14(20)24/h7-10,12-13,22H,1-6H2,(H2,20,24)(H,21,25)/t7-,8-,9?,10?,12?,13?/m1/s1 |
| InChIKey | UGTVLVYBXNXVJN-DCJFSGOWSA-N |
| XLogP | -0.39 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |