C12H18N2O5 — CID 175424255
[1-oxo-1-(oxolan-2-yl)-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl] carbamate (PubChem CID 175424255) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is [1-oxo-1-(oxolan-2-yl)-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl] carbamate.
| Compound Name | [1-oxo-1-(oxolan-2-yl)-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 175424255 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [1-oxo-1-(oxolan-2-yl)-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl] carbamate |
| SMILES | NC(=O)OC(C[C@@H]1CCNC1=O)C(=O)C1CCCO1 |
| InChI | InChI=1S/C12H18N2O5/c13-12(17)19-9(6-7-3-4-14-11(7)16)10(15)8-2-1-5-18-8/h7-9H,1-6H2,(H2,13,17)(H,14,16)/t7-,8?,9?/m0/s1 |
| InChIKey | DVFJNQMKQBFFIU-UEJVZZJDSA-N |
| XLogP | -0.28 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |