C23H33N4O9P — CID 175373227
[(3S)-3-[[(2S)-2-[(3-anilino-3-oxopropanoyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] dihydrogen phosphate (PubChem CID 175373227) has the molecular formula C23H33N4O9P and a molecular weight of 540.51 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-2-[(3-anilino-3-oxopropanoyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] dihydrogen phosphate.
| Compound Name | [(3S)-3-[[(2S)-2-[(3-anilino-3-oxopropanoyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 175373227 |
| Molecular Formula | C23H33N4O9P |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [(3S)-3-[[(2S)-2-[(3-anilino-3-oxopropanoyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] dihydrogen phosphate |
| SMILES | CC(C)C[C@H](NC(=O)CC(=O)Nc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C23H33N4O9P/c1-14(2)10-18(26-21(30)12-20(29)25-16-6-4-3-5-7-16)23(32)27-17(11-15-8-9-24-22(15)31)19(28)13-36-37(33,34)35/h3-7,14-15,17-18H,8-13H2,1-2H3,(H,24,31)(H,25,29)(H,26,30)(H,27,32)(H2,33,34,35)/t15-,17-,18-/m0/s1 |
| InChIKey | LUGJVMLTTHBQSY-SZMVWBNQSA-N |
| XLogP | 0.24 |
| TPSA | 200.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|