C17H28N4O6 — CID 175537584
N'-[1-[[(2S)-4-methoxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide (PubChem CID 175537584) has the molecular formula C17H28N4O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is N'-[1-[[(2S)-4-methoxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide.
| Compound Name | N'-[1-[[(2S)-4-methoxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide |
|---|---|
| PubChem CID | 175537584 |
| Molecular Formula | C17H28N4O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N'-[1-[[(2S)-4-methoxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide |
| SMILES | COCC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)C(CC(C)C)NC(=O)C(N)=O |
| InChI | InChI=1S/C17H28N4O6/c1-9(2)6-12(21-17(26)14(18)23)16(25)20-11(13(22)8-27-3)7-10-4-5-19-15(10)24/h9-12H,4-8H2,1-3H3,(H2,18,23)(H,19,24)(H,20,25)(H,21,26)/t10-,11-,12?/m0/s1 |
| InChIKey | YDYIWAGEECPDQX-NDQFZYFBSA-N |
| XLogP | -1.77 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|