C30H31F5N4O5 — CID 167333802
1-[(2S)-4,4-dimethyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]-5-fluoroindole-2-carboxamide (PubChem CID 167333802) has the molecular formula C30H31F5N4O5 and a molecular weight of 622.59 g/mol. Its IUPAC name is 1-[(2S)-4,4-dimethyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]-5-fluoroindole-2-carboxamide.
| Compound Name | 1-[(2S)-4,4-dimethyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]-5-fluoroindole-2-carboxamide |
|---|---|
| PubChem CID | 167333802 |
| Molecular Formula | C30H31F5N4O5 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 1-[(2S)-4,4-dimethyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]-5-fluoroindole-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H](C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)COc1c(F)c(F)cc(F)c1F)n1c(C(N)=O)cc2cc(F)ccc21 |
| InChI | InChI=1S/C30H31F5N4O5/c1-30(2,3)12-22(39-20-5-4-16(31)8-15(20)10-21(39)27(36)41)29(43)38-19(9-14-6-7-37-28(14)42)23(40)13-44-26-24(34)17(32)11-18(33)25(26)35/h4-5,8,10-11,14,19,22H,6-7,9,12-13H2,1-3H3,(H2,36,41)(H,37,42)(H,38,43)/t14-,19-,22-/m0/s1 |
| InChIKey | NXFZIJLBNBUTBR-DVXDUOKCSA-N |
| XLogP | 4.07 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|