C8H5F4NO2 — CID 2544338
2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 2544338) has the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | 2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2544338 |
| Molecular Formula | C8H5F4NO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | NC(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H5F4NO2/c9-3-1-4(10)7(12)8(6(3)11)15-2-5(13)14/h1H,2H2,(H2,13,14) |
| InChIKey | BDUVUABDLTWPCH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|