C23H17F4N3O5 — CID 19298385
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoate (PubChem CID 19298385) has the molecular formula C23H17F4N3O5 and a molecular weight of 491.40 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 19298385 |
| Molecular Formula | C23H17F4N3O5 |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoate |
| SMILES | NC(=O)COc1ccc(/C(N)=N/OC(=O)c2ccc(COc3c(F)c(F)cc(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C23H17F4N3O5/c24-16-9-17(25)20(27)21(19(16)26)34-10-12-1-3-14(4-2-12)23(32)35-30-22(29)13-5-7-15(8-6-13)33-11-18(28)31/h1-9H,10-11H2,(H2,28,31)(H2,29,30) |
| InChIKey | HMBHKLLRSRYDHJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|